About benzyl 2-(furan-2-yl)acetate
benzyl 2-(furan-2-yl)acetate (PubChem CID 11447250) has the molecular formula C13H12O3
and a molecular weight of 216.24 g/mol. Its IUPAC name is benzyl 2-(furan-2-yl)acetate.
Molecular Properties
| Compound Name | benzyl 2-(furan-2-yl)acetate |
| PubChem CID | 11447250 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | benzyl 2-(furan-2-yl)acetate |
| SMILES | O=C(Cc1ccco1)OCc1ccccc1 |
| InChI | InChI=1S/C13H12O3/c14-13(9-12-7-4-8-15-12)16-10-11-5-2-1-3-6-11/h1-8H,9-10H2 |
| InChIKey | MEUIAGXNVDHICM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl 2-(furan-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-(furan-2-yl)acetate?
The IUPAC name of benzyl 2-(furan-2-yl)acetate (CID 11447250) is benzyl 2-(furan-2-yl)acetate.
What is the SMILES notation for benzyl 2-(furan-2-yl)acetate?
The canonical SMILES for benzyl 2-(furan-2-yl)acetate is O=C(Cc1ccco1)OCc1ccccc1.
What is the InChIKey of benzyl 2-(furan-2-yl)acetate?
The InChIKey is MEUIAGXNVDHICM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O3/c14-13(9-12-7-4-8-15-12)16-10-11-5-2-1-3-6-11/h1-8H,9-10H2.
What are the key properties of benzyl 2-(furan-2-yl)acetate?
benzyl 2-(furan-2-yl)acetate has a molecular weight of 216.24 g/mol, XLogP of 2.57, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(furan-2-yl)acetate is sourced from PubChem (CID 11447250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).