About 2-methylpropyl 2-(furan-2-yl)acetate
2-methylpropyl 2-(furan-2-yl)acetate (PubChem CID 156705031) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-methylpropyl 2-(furan-2-yl)acetate.
Molecular Properties
| Compound Name | 2-methylpropyl 2-(furan-2-yl)acetate |
| PubChem CID | 156705031 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-methylpropyl 2-(furan-2-yl)acetate |
| SMILES | CC(C)COC(=O)Cc1ccco1 |
| InChI | InChI=1S/C10H14O3/c1-8(2)7-13-10(11)6-9-4-3-5-12-9/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | HITHNCXGEZIXDS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylpropyl 2-(furan-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 2-(furan-2-yl)acetate?
The IUPAC name of 2-methylpropyl 2-(furan-2-yl)acetate (CID 156705031) is 2-methylpropyl 2-(furan-2-yl)acetate.
What is the SMILES notation for 2-methylpropyl 2-(furan-2-yl)acetate?
The canonical SMILES for 2-methylpropyl 2-(furan-2-yl)acetate is CC(C)COC(=O)Cc1ccco1.
What is the InChIKey of 2-methylpropyl 2-(furan-2-yl)acetate?
The InChIKey is HITHNCXGEZIXDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3/c1-8(2)7-13-10(11)6-9-4-3-5-12-9/h3-5,8H,6-7H2,1-2H3.
What are the key properties of 2-methylpropyl 2-(furan-2-yl)acetate?
2-methylpropyl 2-(furan-2-yl)acetate has a molecular weight of 182.22 g/mol, XLogP of 2.02, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 2-(furan-2-yl)acetate is sourced from PubChem (CID 156705031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).