C32H30O9 — CID 146540375
benzyl 3-hydroxy-5-[2-[2-(3-hydroxy-5-phenylmethoxycarbonylphenoxy)ethoxy]ethoxy]benzoate (PubChem CID 146540375) has the molecular formula C32H30O9 and a molecular weight of 558.58 g/mol. Its IUPAC name is benzyl 3-hydroxy-5-[2-[2-(3-hydroxy-5-phenylmethoxycarbonylphenoxy)ethoxy]ethoxy]benzoate.
| Compound Name | benzyl 3-hydroxy-5-[2-[2-(3-hydroxy-5-phenylmethoxycarbonylphenoxy)ethoxy]ethoxy]benzoate |
|---|---|
| PubChem CID | 146540375 |
| Molecular Formula | C32H30O9 |
| Molecular Weight | 558.58 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | benzyl 3-hydroxy-5-[2-[2-(3-hydroxy-5-phenylmethoxycarbonylphenoxy)ethoxy]ethoxy]benzoate |
| SMILES | O=C(OCc1ccccc1)c1cc(O)cc(OCCOCCOc2cc(O)cc(C(=O)OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C32H30O9/c33-27-15-25(31(35)40-21-23-7-3-1-4-8-23)17-29(19-27)38-13-11-37-12-14-39-30-18-26(16-28(34)20-30)32(36)41-22-24-9-5-2-6-10-24/h1-10,15-20,33-34H,11-14,21-22H2 |
| InChIKey | QFJVBUFCMVYELU-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|