C31H38O7 — CID 132990681
6-hydroxyhexyl 3,5-bis(2-phenylmethoxyethoxy)benzoate (PubChem CID 132990681) has the molecular formula C31H38O7 and a molecular weight of 522.64 g/mol. Its IUPAC name is 6-hydroxyhexyl 3,5-bis(2-phenylmethoxyethoxy)benzoate.
| Compound Name | 6-hydroxyhexyl 3,5-bis(2-phenylmethoxyethoxy)benzoate |
|---|---|
| PubChem CID | 132990681 |
| Molecular Formula | C31H38O7 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 6-hydroxyhexyl 3,5-bis(2-phenylmethoxyethoxy)benzoate |
| SMILES | O=C(OCCCCCCO)c1cc(OCCOCc2ccccc2)cc(OCCOCc2ccccc2)c1 |
| InChI | InChI=1S/C31H38O7/c32-15-9-1-2-10-16-38-31(33)28-21-29(36-19-17-34-24-26-11-5-3-6-12-26)23-30(22-28)37-20-18-35-25-27-13-7-4-8-14-27/h3-8,11-14,21-23,32H,1-2,9-10,15-20,24-25H2 |
| InChIKey | RMHNAHMSHHNDOG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|