6-hydroxyhexyl 3,5-bis(2-phenylmethoxyethoxy)benzoate

C31H38O7 — CID 132990681

IUPAC6-hydroxyhexyl 3,5-bis(2-phenylmethoxyethoxy)benzoate
SMILESO=C(OCCCCCCO)c1cc(OCCOCc2ccccc2)cc(OCCOCc2ccccc2)c1
InChIInChI=1S/C31H38O7/c32-15-9-1-2-10-16-38-31(33)28-21-29(36-19-17-34-24-26-11-5-3-6-12-26)23-30(22-28)37-20-18-35-25-27-13-7-4-8-14-27/h3-8,11-14,21-23,32H,1-2,9-10,15-20,24-25H2
InChIKeyRMHNAHMSHHNDOG-UHFFFAOYSA-N
MW522.64 g/mol
LogP5.59
Rot. Bonds19

About 6-hydroxyhexyl 3,5-bis(2-phenylmethoxyethoxy)benzoate

6-hydroxyhexyl 3,5-bis(2-phenylmethoxyethoxy)benzoate (PubChem CID 132990681) has the molecular formula C31H38O7 and a molecular weight of 522.64 g/mol. Its IUPAC name is 6-hydroxyhexyl 3,5-bis(2-phenylmethoxyethoxy)benzoate.

Molecular Properties

Compound Name6-hydroxyhexyl 3,5-bis(2-phenylmethoxyethoxy)benzoate
PubChem CID132990681
Molecular FormulaC31H38O7
Molecular Weight522.64 g/mol
Exact Mass522.26
IUPAC Name6-hydroxyhexyl 3,5-bis(2-phenylmethoxyethoxy)benzoate
SMILESO=C(OCCCCCCO)c1cc(OCCOCc2ccccc2)cc(OCCOCc2ccccc2)c1
InChIInChI=1S/C31H38O7/c32-15-9-1-2-10-16-38-31(33)28-21-29(36-19-17-34-24-26-11-5-3-6-12-26)23-30(22-28)37-20-18-35-25-27-13-7-4-8-14-27/h3-8,11-14,21-23,32H,1-2,9-10,15-20,24-25H2
InChIKeyRMHNAHMSHHNDOG-UHFFFAOYSA-N
XLogP5.59
TPSA83.45 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds19
Heavy Atoms38
Complexity—

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500522.64
LogP ≤ 55.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 6-hydroxyhexyl 3,5-bis(2-phenylmethoxyethoxy)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-hydroxyhexyl 3,5-bis(2-phenylmethoxyethoxy)benzoate?
The IUPAC name of 6-hydroxyhexyl 3,5-bis(2-phenylmethoxyethoxy)benzoate (CID 132990681) is 6-hydroxyhexyl 3,5-bis(2-phenylmethoxyethoxy)benzoate.
What is the SMILES notation for 6-hydroxyhexyl 3,5-bis(2-phenylmethoxyethoxy)benzoate?
The canonical SMILES for 6-hydroxyhexyl 3,5-bis(2-phenylmethoxyethoxy)benzoate is O=C(OCCCCCCO)c1cc(OCCOCc2ccccc2)cc(OCCOCc2ccccc2)c1.
What is the InChIKey of 6-hydroxyhexyl 3,5-bis(2-phenylmethoxyethoxy)benzoate?
The InChIKey is RMHNAHMSHHNDOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H38O7/c32-15-9-1-2-10-16-38-31(33)28-21-29(36-19-17-34-24-26-11-5-3-6-12-26)23-30(22-28)37-20-18-35-25-27-13-7-4-8-14-27/h3-8,11-14,21-23,32H,1-2,9-10,15-20,24-25H2.
What are the key properties of 6-hydroxyhexyl 3,5-bis(2-phenylmethoxyethoxy)benzoate?
6-hydroxyhexyl 3,5-bis(2-phenylmethoxyethoxy)benzoate has a molecular weight of 522.64 g/mol, XLogP of 5.59, 19 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxyhexyl 3,5-bis(2-phenylmethoxyethoxy)benzoate is sourced from PubChem (CID 132990681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).