C35H54O14 — CID 166142835
methyl 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5-[2-[2-(2-methoxyethoxy)-1-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]benzoate (PubChem CID 166142835) has the molecular formula C35H54O14 and a molecular weight of 698.80 g/mol. Its IUPAC name is methyl 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5-[2-[2-(2-methoxyethoxy)-1-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]benzoate.
| Compound Name | methyl 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5-[2-[2-(2-methoxyethoxy)-1-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]benzoate |
|---|---|
| PubChem CID | 166142835 |
| Molecular Formula | C35H54O14 |
| Molecular Weight | 698.80 g/mol |
| Exact Mass | 698.35 |
| IUPAC Name | methyl 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5-[2-[2-(2-methoxyethoxy)-1-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]benzoate |
| SMILES | COCCOCCOCCOc1cc(OCCOC(COCCOC)OCCOCCOCCOCc2ccccc2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C35H54O14/c1-37-9-11-40-13-15-42-19-21-46-32-25-31(35(36)39-3)26-33(27-32)47-23-24-49-34(29-45-12-10-38-2)48-22-20-43-16-14-41-17-18-44-28-30-7-5-4-6-8-30/h4-8,25-27,34H,9-24,28-29H2,1-3H3 |
| InChIKey | WGDKRTZFCLEBLG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 137.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.80 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|