C19H24O5S — CID 161286829
methyl 3-[(2S)-1-methoxypropan-2-yl]oxy-5-phenylmethoxybenzoate;sulfane (PubChem CID 161286829) has the molecular formula C19H24O5S and a molecular weight of 364.46 g/mol. Its IUPAC name is methyl 3-[(2S)-1-methoxypropan-2-yl]oxy-5-phenylmethoxybenzoate;sulfane.
| Compound Name | methyl 3-[(2S)-1-methoxypropan-2-yl]oxy-5-phenylmethoxybenzoate;sulfane |
|---|---|
| PubChem CID | 161286829 |
| Molecular Formula | C19H24O5S |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | methyl 3-[(2S)-1-methoxypropan-2-yl]oxy-5-phenylmethoxybenzoate;sulfane |
| SMILES | COC[C@H](C)Oc1cc(OCc2ccccc2)cc(C(=O)OC)c1.S |
| InChI | InChI=1S/C19H22O5.H2S/c1-14(12-21-2)24-18-10-16(19(20)22-3)9-17(11-18)23-13-15-7-5-4-6-8-15;/h4-11,14H,12-13H2,1-3H3;1H2/t14-;/m0./s1 |
| InChIKey | VFVFOJGYKIOQNC-UQKRIMTDSA-N |
| XLogP | 3.58 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |