C29H40N2O6 — CID 143059938
ethane;methyl (2E)-2-[[1-[[3-(1-methoxypropan-2-yloxy)-5-phenylmethoxybenzoyl]amino]propylideneamino]methylidene]butanoate (PubChem CID 143059938) has the molecular formula C29H40N2O6 and a molecular weight of 512.65 g/mol. Its IUPAC name is ethane;methyl (2E)-2-[[1-[[3-(1-methoxypropan-2-yloxy)-5-phenylmethoxybenzoyl]amino]propylideneamino]methylidene]butanoate.
| Compound Name | ethane;methyl (2E)-2-[[1-[[3-(1-methoxypropan-2-yloxy)-5-phenylmethoxybenzoyl]amino]propylideneamino]methylidene]butanoate |
|---|---|
| PubChem CID | 143059938 |
| Molecular Formula | C29H40N2O6 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | ethane;methyl (2E)-2-[[1-[[3-(1-methoxypropan-2-yloxy)-5-phenylmethoxybenzoyl]amino]propylideneamino]methylidene]butanoate |
| SMILES | CC.CC/C(=C\N=C(/CC)NC(=O)c1cc(OCc2ccccc2)cc(OC(C)COC)c1)C(=O)OC |
| InChI | InChI=1S/C27H34N2O6.C2H6/c1-6-21(27(31)33-5)16-28-25(7-2)29-26(30)22-13-23(34-18-20-11-9-8-10-12-20)15-24(14-22)35-19(3)17-32-4;1-2/h8-16,19H,6-7,17-18H2,1-5H3,(H,28,29,30);1-2H3/b21-16+; |
| InChIKey | WWDUJIOLHLNNJO-JEBHESKQSA-N |
| XLogP | 5.71 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|