C20H24O4 — CID 67489263
1-(1-methoxyethenyl)-3-[(2S)-1-methoxypropan-2-yl]oxy-5-phenylmethoxybenzene (PubChem CID 67489263) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is 1-(1-methoxyethenyl)-3-[(2S)-1-methoxypropan-2-yl]oxy-5-phenylmethoxybenzene.
| Compound Name | 1-(1-methoxyethenyl)-3-[(2S)-1-methoxypropan-2-yl]oxy-5-phenylmethoxybenzene |
|---|---|
| PubChem CID | 67489263 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 1-(1-methoxyethenyl)-3-[(2S)-1-methoxypropan-2-yl]oxy-5-phenylmethoxybenzene |
| SMILES | C=C(OC)c1cc(OCc2ccccc2)cc(O[C@@H](C)COC)c1 |
| InChI | InChI=1S/C20H24O4/c1-15(13-21-3)24-20-11-18(16(2)22-4)10-19(12-20)23-14-17-8-6-5-7-9-17/h5-12,15H,2,13-14H2,1,3-4H3/t15-/m0/s1 |
| InChIKey | JLVTXNAHXPONES-HNNXBMFYSA-N |
| XLogP | 4.30 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|