C26H30O12 — CID 57387038
dimethyl 5-[2-[2-[2-[3,5-bis(methoxycarbonyl)phenoxy]ethoxy]ethoxy]ethoxy]benzene-1,3-dicarboxylate (PubChem CID 57387038) has the molecular formula C26H30O12 and a molecular weight of 534.51 g/mol. Its IUPAC name is dimethyl 5-[2-[2-[2-[3,5-bis(methoxycarbonyl)phenoxy]ethoxy]ethoxy]ethoxy]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[2-[2-[2-[3,5-bis(methoxycarbonyl)phenoxy]ethoxy]ethoxy]ethoxy]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 57387038 |
| Molecular Formula | C26H30O12 |
| Molecular Weight | 534.51 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | dimethyl 5-[2-[2-[2-[3,5-bis(methoxycarbonyl)phenoxy]ethoxy]ethoxy]ethoxy]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OCCOCCOCCOc2cc(C(=O)OC)cc(C(=O)OC)c2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C26H30O12/c1-31-23(27)17-11-18(24(28)32-2)14-21(13-17)37-9-7-35-5-6-36-8-10-38-22-15-19(25(29)33-3)12-20(16-22)26(30)34-4/h11-16H,5-10H2,1-4H3 |
| InChIKey | LYJHMQZOTQVOBC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|