C18H17ClO6 — CID 17391117
dimethyl 5-[2-(2-chlorophenoxy)ethoxy]benzene-1,3-dicarboxylate (PubChem CID 17391117) has the molecular formula C18H17ClO6 and a molecular weight of 364.78 g/mol. Its IUPAC name is dimethyl 5-[2-(2-chlorophenoxy)ethoxy]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[2-(2-chlorophenoxy)ethoxy]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 17391117 |
| Molecular Formula | C18H17ClO6 |
| Molecular Weight | 364.78 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | dimethyl 5-[2-(2-chlorophenoxy)ethoxy]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OCCOc2ccccc2Cl)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C18H17ClO6/c1-22-17(20)12-9-13(18(21)23-2)11-14(10-12)24-7-8-25-16-6-4-3-5-15(16)19/h3-6,9-11H,7-8H2,1-2H3 |
| InChIKey | LDCZHDTUCFIIBC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.78 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|