C12H13O6- — CID 170984662
3-methoxycarbonyl-5-(2-methoxyethoxy)benzoate (PubChem CID 170984662) has the molecular formula C12H13O6- and a molecular weight of 253.23 g/mol. Its IUPAC name is 3-methoxycarbonyl-5-(2-methoxyethoxy)benzoate.
| Compound Name | 3-methoxycarbonyl-5-(2-methoxyethoxy)benzoate |
|---|---|
| PubChem CID | 170984662 |
| Molecular Formula | C12H13O6- |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 3-methoxycarbonyl-5-(2-methoxyethoxy)benzoate |
| SMILES | COCCOc1cc(C(=O)[O-])cc(C(=O)OC)c1 |
| InChI | InChI=1S/C12H14O6/c1-16-3-4-18-10-6-8(11(13)14)5-9(7-10)12(15)17-2/h5-7H,3-4H2,1-2H3,(H,13,14)/p-1 |
| InChIKey | VDMWCEVJILEBCJ-UHFFFAOYSA-M |
| XLogP | -0.14 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|