methyl 3,5-bis(2-fluoroethoxy)benzoate

C12H14F2O4 — CID 86609559

IUPACmethyl 3,5-bis(2-fluoroethoxy)benzoate
SMILESCOC(=O)c1cc(OCCF)cc(OCCF)c1
InChIInChI=1S/C12H14F2O4/c1-16-12(15)9-6-10(17-4-2-13)8-11(7-9)18-5-3-14/h6-8H,2-5H2,1H3
InChIKeyYWYWDYUHZJZENL-UHFFFAOYSA-N
MW260.24 g/mol
LogP2.17
Rot. Bonds7

About methyl 3,5-bis(2-fluoroethoxy)benzoate

methyl 3,5-bis(2-fluoroethoxy)benzoate (PubChem CID 86609559) has the molecular formula C12H14F2O4 and a molecular weight of 260.24 g/mol. Its IUPAC name is methyl 3,5-bis(2-fluoroethoxy)benzoate.

Molecular Properties

Compound Namemethyl 3,5-bis(2-fluoroethoxy)benzoate
PubChem CID86609559
Molecular FormulaC12H14F2O4
Molecular Weight260.24 g/mol
Exact Mass260.09
IUPAC Namemethyl 3,5-bis(2-fluoroethoxy)benzoate
SMILESCOC(=O)c1cc(OCCF)cc(OCCF)c1
InChIInChI=1S/C12H14F2O4/c1-16-12(15)9-6-10(17-4-2-13)8-11(7-9)18-5-3-14/h6-8H,2-5H2,1H3
InChIKeyYWYWDYUHZJZENL-UHFFFAOYSA-N
XLogP2.17
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.24
LogP ≤ 52.17
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3,5-bis(2-fluoroethoxy)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

methyl 3-(2-fluoroethoxy)benzoate
CID 15058632
methyl 3,5-bis(2-chloroethoxy)benzoate
CID 100923076
dimethyl 5-[2-[2-[2-[3,5-bis(methoxycarbonyl)phenoxy]ethoxy]ethoxy]ethoxy]benzene-1,3-dicarboxylate
CID 57387038
methyl 3-pentadecoxy-5-undecoxybenzoate
CID 166142932
methyl 3,5-di(nonoxy)benzoate
CID 69305989
methyl 3,5-bis(4-oxobutoxy)benzoate
CID 11209019
1,3,5-tris(2-fluoroethoxy)benzene
CID 22164154
3-methoxycarbonyl-5-(2-methoxyethoxy)benzoate
CID 170984662
methyl 3,5-bis(prop-2-ynoxy)benzoate
CID 3566176
methyl 4-(2-fluoroethoxy)-3-methoxybenzoate
CID 90061966
methyl 3,5-bis[3-(4-phenylphenoxy)propoxy]benzoate
CID 15233464
methyl 3,5-bis[3-(4-phenylmethoxyphenoxy)propoxy]benzoate
CID 54529309

Frequently Asked Questions

What is the IUPAC name of methyl 3,5-bis(2-fluoroethoxy)benzoate?
The IUPAC name of methyl 3,5-bis(2-fluoroethoxy)benzoate (CID 86609559) is methyl 3,5-bis(2-fluoroethoxy)benzoate.
What is the SMILES notation for methyl 3,5-bis(2-fluoroethoxy)benzoate?
The canonical SMILES for methyl 3,5-bis(2-fluoroethoxy)benzoate is COC(=O)c1cc(OCCF)cc(OCCF)c1.
What is the InChIKey of methyl 3,5-bis(2-fluoroethoxy)benzoate?
The InChIKey is YWYWDYUHZJZENL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2O4/c1-16-12(15)9-6-10(17-4-2-13)8-11(7-9)18-5-3-14/h6-8H,2-5H2,1H3.
What are the key properties of methyl 3,5-bis(2-fluoroethoxy)benzoate?
methyl 3,5-bis(2-fluoroethoxy)benzoate has a molecular weight of 260.24 g/mol, XLogP of 2.17, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,5-bis(2-fluoroethoxy)benzoate is sourced from PubChem (CID 86609559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).