C12H15F3O3 — CID 22164154
1,3,5-tris(2-fluoroethoxy)benzene (PubChem CID 22164154) has the molecular formula C12H15F3O3 and a molecular weight of 264.24 g/mol. Its IUPAC name is 1,3,5-tris(2-fluoroethoxy)benzene.
| Compound Name | 1,3,5-tris(2-fluoroethoxy)benzene |
|---|---|
| PubChem CID | 22164154 |
| Molecular Formula | C12H15F3O3 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 1,3,5-tris(2-fluoroethoxy)benzene |
| SMILES | FCCOc1cc(OCCF)cc(OCCF)c1 |
| InChI | InChI=1S/C12H15F3O3/c13-1-4-16-10-7-11(17-5-2-14)9-12(8-10)18-6-3-15/h7-9H,1-6H2 |
| InChIKey | OCZOKFGOZCDCEI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |