C12H11NO5 — CID 8536461
dimethyl 5-(cyanomethoxy)benzene-1,3-dicarboxylate (PubChem CID 8536461) has the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. Its IUPAC name is dimethyl 5-(cyanomethoxy)benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-(cyanomethoxy)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 8536461 |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | dimethyl 5-(cyanomethoxy)benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OCC#N)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C12H11NO5/c1-16-11(14)8-5-9(12(15)17-2)7-10(6-8)18-4-3-13/h5-7H,4H2,1-2H3 |
| InChIKey | GKMIWZYAWUNYLT-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |