C32H34N2O12S2 — CID 122393646
dimethyl 5-[2-[2-[(Z)-2-[2-[2-[3,5-bis(methoxycarbonyl)phenoxy]ethoxy]ethylsulfanyl]-1,2-dicyanoethenyl]sulfanylethoxy]ethoxy]benzene-1,3-dicarboxylate (PubChem CID 122393646) has the molecular formula C32H34N2O12S2 and a molecular weight of 702.76 g/mol. Its IUPAC name is dimethyl 5-[2-[2-[(Z)-2-[2-[2-[3,5-bis(methoxycarbonyl)phenoxy]ethoxy]ethylsulfanyl]-1,2-dicyanoethenyl]sulfanylethoxy]ethoxy]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[2-[2-[(Z)-2-[2-[2-[3,5-bis(methoxycarbonyl)phenoxy]ethoxy]ethylsulfanyl]-1,2-dicyanoethenyl]sulfanylethoxy]ethoxy]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 122393646 |
| Molecular Formula | C32H34N2O12S2 |
| Molecular Weight | 702.76 g/mol |
| Exact Mass | 702.16 |
| IUPAC Name | dimethyl 5-[2-[2-[(Z)-2-[2-[2-[3,5-bis(methoxycarbonyl)phenoxy]ethoxy]ethylsulfanyl]-1,2-dicyanoethenyl]sulfanylethoxy]ethoxy]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OCCOCCS/C(C#N)=C(/C#N)SCCOCCOc2cc(C(=O)OC)cc(C(=O)OC)c2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C32H34N2O12S2/c1-39-29(35)21-13-22(30(36)40-2)16-25(15-21)45-7-5-43-9-11-47-27(19-33)28(20-34)48-12-10-44-6-8-46-26-17-23(31(37)41-3)14-24(18-26)32(38)42-4/h13-18H,5-12H2,1-4H3/b28-27- |
| InChIKey | VCCMZCKNRSEVRQ-DQSJHHFOSA-N |
| XLogP | 4.05 |
| TPSA | 189.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.76 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|