About 5-(oxidomethoxy)benzene-1,3-dicarboxylate
5-(oxidomethoxy)benzene-1,3-dicarboxylate (PubChem CID 59464901) has the molecular formula C9H5O6-3
and a molecular weight of 209.13 g/mol. Its IUPAC name is 5-(oxidomethoxy)benzene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | 5-(oxidomethoxy)benzene-1,3-dicarboxylate |
| PubChem CID | 59464901 |
| Molecular Formula | C9H5O6-3 |
| Molecular Weight | 209.13 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | 5-(oxidomethoxy)benzene-1,3-dicarboxylate |
| SMILES | O=C([O-])c1cc(OC[O-])cc(C(=O)[O-])c1 |
| InChI | InChI=1S/C9H7O6/c10-4-15-7-2-5(8(11)12)1-6(3-7)9(13)14/h1-3H,4H2,(H,11,12)(H,13,14)/q-1/p-2 |
| InChIKey | VAPBKFAQQZHUSR-UHFFFAOYSA-L |
| XLogP | -2.89 |
| TPSA | 112.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.13 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-(oxidomethoxy)benzene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(oxidomethoxy)benzene-1,3-dicarboxylate?
The IUPAC name of 5-(oxidomethoxy)benzene-1,3-dicarboxylate (CID 59464901) is 5-(oxidomethoxy)benzene-1,3-dicarboxylate.
What is the SMILES notation for 5-(oxidomethoxy)benzene-1,3-dicarboxylate?
The canonical SMILES for 5-(oxidomethoxy)benzene-1,3-dicarboxylate is O=C([O-])c1cc(OC[O-])cc(C(=O)[O-])c1.
What is the InChIKey of 5-(oxidomethoxy)benzene-1,3-dicarboxylate?
The InChIKey is VAPBKFAQQZHUSR-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H7O6/c10-4-15-7-2-5(8(11)12)1-6(3-7)9(13)14/h1-3H,4H2,(H,11,12)(H,13,14)/q-1/p-2.
What are the key properties of 5-(oxidomethoxy)benzene-1,3-dicarboxylate?
5-(oxidomethoxy)benzene-1,3-dicarboxylate has a molecular weight of 209.13 g/mol, XLogP of -2.89, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(oxidomethoxy)benzene-1,3-dicarboxylate is sourced from PubChem (CID 59464901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).