About 3-methoxybenzoic acid
3-methoxybenzoic acid (PubChem CID 11461) has the molecular formula C8H8O3
and a molecular weight of 152.15 g/mol. Its IUPAC name is 3-methoxybenzoic acid.
Molecular Properties
| Compound Name | 3-methoxybenzoic acid |
| PubChem CID | 11461 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 3-methoxybenzoic acid |
| SMILES | COc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C8H8O3/c1-11-7-4-2-3-6(5-7)8(9)10/h2-5H,1H3,(H,9,10) |
| InChIKey | XHQZJYCNDZAGLW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxybenzoic acid?
The IUPAC name of 3-methoxybenzoic acid (CID 11461) is 3-methoxybenzoic acid.
What is the SMILES notation for 3-methoxybenzoic acid?
The canonical SMILES for 3-methoxybenzoic acid is COc1cccc(C(=O)O)c1.
What is the InChIKey of 3-methoxybenzoic acid?
The InChIKey is XHQZJYCNDZAGLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3/c1-11-7-4-2-3-6(5-7)8(9)10/h2-5H,1H3,(H,9,10).
What are the key properties of 3-methoxybenzoic acid?
3-methoxybenzoic acid has a molecular weight of 152.15 g/mol, XLogP of 1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxybenzoic acid is sourced from PubChem (CID 11461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).