C44H82O19 — CID 139525451
2,3-bis[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propoxymethylbenzene (PubChem CID 139525451) has the molecular formula C44H82O19 and a molecular weight of 915.12 g/mol. Its IUPAC name is 2,3-bis[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propoxymethylbenzene.
| Compound Name | 2,3-bis[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propoxymethylbenzene |
|---|---|
| PubChem CID | 139525451 |
| Molecular Formula | C44H82O19 |
| Molecular Weight | 915.12 g/mol |
| Exact Mass | 914.55 |
| IUPAC Name | 2,3-bis[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propoxymethylbenzene |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCC(COCc1ccccc1)OCCOCCOCCOCCOCCOCCOCCOCCOC |
| InChI | InChI=1S/C44H82O19/c1-45-8-10-47-12-14-49-16-18-51-20-22-53-24-25-55-28-29-57-32-33-59-36-37-61-41-44(42-62-40-43-6-4-3-5-7-43)63-39-38-60-35-34-58-31-30-56-27-26-54-23-21-52-19-17-50-15-13-48-11-9-46-2/h3-7,44H,8-42H2,1-2H3 |
| InChIKey | ICEFQQRQWSQHCK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 175.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 55 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.12 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|