C34H58O14 — CID 169059619
8-[2-(7-carboxyheptoxy)-3-[2-[2-[2-(2-phenylmethoxyethylperoxy)ethylperoxy]ethylperoxy]ethoxy]propoxy]octanoic acid (PubChem CID 169059619) has the molecular formula C34H58O14 and a molecular weight of 690.82 g/mol. Its IUPAC name is 8-[2-(7-carboxyheptoxy)-3-[2-[2-[2-(2-phenylmethoxyethylperoxy)ethylperoxy]ethylperoxy]ethoxy]propoxy]octanoic acid.
| Compound Name | 8-[2-(7-carboxyheptoxy)-3-[2-[2-[2-(2-phenylmethoxyethylperoxy)ethylperoxy]ethylperoxy]ethoxy]propoxy]octanoic acid |
|---|---|
| PubChem CID | 169059619 |
| Molecular Formula | C34H58O14 |
| Molecular Weight | 690.82 g/mol |
| Exact Mass | 690.38 |
| IUPAC Name | 8-[2-(7-carboxyheptoxy)-3-[2-[2-[2-(2-phenylmethoxyethylperoxy)ethylperoxy]ethylperoxy]ethoxy]propoxy]octanoic acid |
| SMILES | O=C(O)CCCCCCCOCC(COCCOOCCOOCCOOCCOCc1ccccc1)OCCCCCCCC(=O)O |
| InChI | InChI=1S/C34H58O14/c35-33(36)16-10-3-1-5-12-18-39-29-32(42-19-13-6-2-4-11-17-34(37)38)30-41-21-23-44-46-25-27-48-47-26-24-45-43-22-20-40-28-31-14-8-7-9-15-31/h7-9,14-15,32H,1-6,10-13,16-30H2,(H,35,36)(H,37,38) |
| InChIKey | IBDUTAZMXHFPKW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 166.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.82 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|