C58H106O14 — CID 169059655
2-butyloctyl 8-[2-[8-oxo-8-(2-pentylheptoxy)octoxy]-3-[2-[2-[2-(2-phenylmethoxyethylperoxy)ethylperoxy]ethylperoxy]ethoxy]propoxy]octanoate (PubChem CID 169059655) has the molecular formula C58H106O14 and a molecular weight of 1027.47 g/mol. Its IUPAC name is 2-butyloctyl 8-[2-[8-oxo-8-(2-pentylheptoxy)octoxy]-3-[2-[2-[2-(2-phenylmethoxyethylperoxy)ethylperoxy]ethylperoxy]ethoxy]propoxy]octanoate.
| Compound Name | 2-butyloctyl 8-[2-[8-oxo-8-(2-pentylheptoxy)octoxy]-3-[2-[2-[2-(2-phenylmethoxyethylperoxy)ethylperoxy]ethylperoxy]ethoxy]propoxy]octanoate |
|---|---|
| PubChem CID | 169059655 |
| Molecular Formula | C58H106O14 |
| Molecular Weight | 1027.47 g/mol |
| Exact Mass | 1026.76 |
| IUPAC Name | 2-butyloctyl 8-[2-[8-oxo-8-(2-pentylheptoxy)octoxy]-3-[2-[2-[2-(2-phenylmethoxyethylperoxy)ethylperoxy]ethylperoxy]ethoxy]propoxy]octanoate |
| SMILES | CCCCCCC(CCCC)COC(=O)CCCCCCCOCC(COCCOOCCOOCCOOCCOCc1ccccc1)OCCCCCCCC(=O)OCC(CCCCC)CCCCC |
| InChI | InChI=1S/C58H106O14/c1-5-9-13-23-35-54(30-12-8-4)49-65-57(59)36-26-16-14-18-28-38-61-51-56(64-39-29-19-15-17-27-37-58(60)66-50-55(31-21-10-6-2)32-22-11-7-3)52-63-41-43-68-70-45-47-72-71-46-44-69-67-42-40-62-48-53-33-24-20-25-34-53/h20,24-25,33-34,54-56H,5-19,21-23,26-32,35-52H2,1-4H3 |
| InChIKey | OPBNOISLHXHSFY-UHFFFAOYSA-N |
| XLogP | 13.79 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 58 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.47 |
| LogP ≤ 5 | 13.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|