C31H54O4 — CID 170035324
[2-(hydroxymethyl)-6-phenylmethoxyhexyl] 3-hexylundecanoate (PubChem CID 170035324) has the molecular formula C31H54O4 and a molecular weight of 490.77 g/mol. Its IUPAC name is [2-(hydroxymethyl)-6-phenylmethoxyhexyl] 3-hexylundecanoate.
| Compound Name | [2-(hydroxymethyl)-6-phenylmethoxyhexyl] 3-hexylundecanoate |
|---|---|
| PubChem CID | 170035324 |
| Molecular Formula | C31H54O4 |
| Molecular Weight | 490.77 g/mol |
| Exact Mass | 490.40 |
| IUPAC Name | [2-(hydroxymethyl)-6-phenylmethoxyhexyl] 3-hexylundecanoate |
| SMILES | CCCCCCCCC(CCCCCC)CC(=O)OCC(CO)CCCCOCc1ccccc1 |
| InChI | InChI=1S/C31H54O4/c1-3-5-7-9-10-13-19-28(18-12-8-6-4-2)24-31(33)35-27-30(25-32)22-16-17-23-34-26-29-20-14-11-15-21-29/h11,14-15,20-21,28,30,32H,3-10,12-13,16-19,22-27H2,1-2H3 |
| InChIKey | OJSACNBZSRNIOQ-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.77 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|