C50H78O5 — CID 169317564
[2-[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxymethyl]-6-phenylmethoxyhexyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 169317564) has the molecular formula C50H78O5 and a molecular weight of 759.17 g/mol. Its IUPAC name is [2-[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxymethyl]-6-phenylmethoxyhexyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | [2-[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxymethyl]-6-phenylmethoxyhexyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 169317564 |
| Molecular Formula | C50H78O5 |
| Molecular Weight | 759.17 g/mol |
| Exact Mass | 758.58 |
| IUPAC Name | [2-[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxymethyl]-6-phenylmethoxyhexyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OCC(CCCCOCc1ccccc1)COC(=O)CCCCCCC/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C50H78O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-34-41-49(51)54-45-48(40-36-37-43-53-44-47-38-32-31-33-39-47)46-55-50(52)42-35-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5-8,11-14,17-20,31-33,38-39,48H,3-4,9-10,15-16,21-30,34-37,40-46H2,1-2H3/b7-5-,8-6-,13-11-,14-12-,19-17-,20-18- |
| InChIKey | JLNAAQRMTAGTGK-YTWBPVBXSA-N |
| XLogP | 14.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.17 |
| LogP ≤ 5 | 14.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|