C30H52O5 — CID 170035753
[2-(1-hydroxyoctoxymethyl)-6-phenylmethoxyhexyl] octanoate (PubChem CID 170035753) has the molecular formula C30H52O5 and a molecular weight of 492.74 g/mol. Its IUPAC name is [2-(1-hydroxyoctoxymethyl)-6-phenylmethoxyhexyl] octanoate.
| Compound Name | [2-(1-hydroxyoctoxymethyl)-6-phenylmethoxyhexyl] octanoate |
|---|---|
| PubChem CID | 170035753 |
| Molecular Formula | C30H52O5 |
| Molecular Weight | 492.74 g/mol |
| Exact Mass | 492.38 |
| IUPAC Name | [2-(1-hydroxyoctoxymethyl)-6-phenylmethoxyhexyl] octanoate |
| SMILES | CCCCCCCC(=O)OCC(CCCCOCc1ccccc1)COC(O)CCCCCCC |
| InChI | InChI=1S/C30H52O5/c1-3-5-7-9-14-21-29(31)34-25-28(26-35-30(32)22-15-10-8-6-4-2)20-16-17-23-33-24-27-18-12-11-13-19-27/h11-13,18-19,28-29,31H,3-10,14-17,20-26H2,1-2H3 |
| InChIKey | DCOITYBNCCSWNY-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.74 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|