C31H52O5 — CID 118165534
[2-(octanoyloxymethyl)-7-phenylmethoxyheptyl] octanoate (PubChem CID 118165534) has the molecular formula C31H52O5 and a molecular weight of 504.75 g/mol. Its IUPAC name is [2-(octanoyloxymethyl)-7-phenylmethoxyheptyl] octanoate.
| Compound Name | [2-(octanoyloxymethyl)-7-phenylmethoxyheptyl] octanoate |
|---|---|
| PubChem CID | 118165534 |
| Molecular Formula | C31H52O5 |
| Molecular Weight | 504.75 g/mol |
| Exact Mass | 504.38 |
| IUPAC Name | [2-(octanoyloxymethyl)-7-phenylmethoxyheptyl] octanoate |
| SMILES | CCCCCCCC(=O)OCC(CCCCCOCc1ccccc1)COC(=O)CCCCCCC |
| InChI | InChI=1S/C31H52O5/c1-3-5-7-9-16-22-30(32)35-26-29(27-36-31(33)23-17-10-8-6-4-2)21-15-12-18-24-34-25-28-19-13-11-14-20-28/h11,13-14,19-20,29H,3-10,12,15-18,21-27H2,1-2H3 |
| InChIKey | VRVQBJCNGCDBFP-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.75 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|