C68H126O11 — CID 168985579
heptadecan-9-yl 8-[(2S)-2-(8-heptadecan-9-yloxy-8-oxooctoxy)-3-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]propoxy]octanoate (PubChem CID 168985579) has the molecular formula C68H126O11 and a molecular weight of 1119.74 g/mol. Its IUPAC name is heptadecan-9-yl 8-[(2S)-2-(8-heptadecan-9-yloxy-8-oxooctoxy)-3-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]propoxy]octanoate.
| Compound Name | heptadecan-9-yl 8-[(2S)-2-(8-heptadecan-9-yloxy-8-oxooctoxy)-3-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]propoxy]octanoate |
|---|---|
| PubChem CID | 168985579 |
| Molecular Formula | C68H126O11 |
| Molecular Weight | 1119.74 g/mol |
| Exact Mass | 1118.93 |
| IUPAC Name | heptadecan-9-yl 8-[(2S)-2-(8-heptadecan-9-yloxy-8-oxooctoxy)-3-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]propoxy]octanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCOC[C@@H](COCCOCCOCCOCCOCc1ccccc1)OCCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C68H126O11/c1-5-9-13-17-23-34-44-64(45-35-24-18-14-10-6-2)78-67(69)48-38-27-21-29-40-50-74-61-66(62-76-59-57-73-55-53-71-52-54-72-56-58-75-60-63-42-32-31-33-43-63)77-51-41-30-22-28-39-49-68(70)79-65(46-36-25-19-15-11-7-3)47-37-26-20-16-12-8-4/h31-33,42-43,64-66H,5-30,34-41,44-62H2,1-4H3/t66-/m0/s1 |
| InChIKey | NOIKNHOHINZIFH-FGKSCKJQSA-N |
| XLogP | 18.18 |
| TPSA | 117.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 65 |
| Heavy Atoms | 79 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1119.74 |
| LogP ≤ 5 | 18.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|