C45H86O8 — CID 168985500
2,3-bis(6-oxo-6-pentadecan-7-yloxyhexoxy)propanoic acid (PubChem CID 168985500) has the molecular formula C45H86O8 and a molecular weight of 755.17 g/mol. Its IUPAC name is 2,3-bis(6-oxo-6-pentadecan-7-yloxyhexoxy)propanoic acid.
| Compound Name | 2,3-bis(6-oxo-6-pentadecan-7-yloxyhexoxy)propanoic acid |
|---|---|
| PubChem CID | 168985500 |
| Molecular Formula | C45H86O8 |
| Molecular Weight | 755.17 g/mol |
| Exact Mass | 754.63 |
| IUPAC Name | 2,3-bis(6-oxo-6-pentadecan-7-yloxyhexoxy)propanoic acid |
| SMILES | CCCCCCCCC(CCCCCC)OC(=O)CCCCCOCC(OCCCCCC(=O)OC(CCCCCC)CCCCCCCC)C(=O)O |
| InChI | InChI=1S/C45H86O8/c1-5-9-13-17-19-25-33-40(31-23-15-11-7-3)52-43(46)35-27-21-29-37-50-39-42(45(48)49)51-38-30-22-28-36-44(47)53-41(32-24-16-12-8-4)34-26-20-18-14-10-6-2/h40-42H,5-39H2,1-4H3,(H,48,49) |
| InChIKey | SSHGZEVFAGRNGQ-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.17 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|