C39H70O7 — CID 168985477
hexadecan-7-yl 6-[2-(6-hydroxyhexoxy)-3-phenylmethoxypropoxy]hexyl carbonate (PubChem CID 168985477) has the molecular formula C39H70O7 and a molecular weight of 650.98 g/mol. Its IUPAC name is hexadecan-7-yl 6-[2-(6-hydroxyhexoxy)-3-phenylmethoxypropoxy]hexyl carbonate.
| Compound Name | hexadecan-7-yl 6-[2-(6-hydroxyhexoxy)-3-phenylmethoxypropoxy]hexyl carbonate |
|---|---|
| PubChem CID | 168985477 |
| Molecular Formula | C39H70O7 |
| Molecular Weight | 650.98 g/mol |
| Exact Mass | 650.51 |
| IUPAC Name | hexadecan-7-yl 6-[2-(6-hydroxyhexoxy)-3-phenylmethoxypropoxy]hexyl carbonate |
| SMILES | CCCCCCCCCC(CCCCCC)OC(=O)OCCCCCCOCC(COCc1ccccc1)OCCCCCCO |
| InChI | InChI=1S/C39H70O7/c1-3-5-7-9-10-11-20-28-37(27-19-8-6-4-2)46-39(41)45-32-24-15-14-22-30-42-34-38(44-31-23-13-12-21-29-40)35-43-33-36-25-17-16-18-26-36/h16-18,25-26,37-38,40H,3-15,19-24,27-35H2,1-2H3 |
| InChIKey | BTJRWWFLIOKFGN-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.98 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|