C25H34O2 — CID 151994242
benzyl (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate (PubChem CID 151994242) has the molecular formula C25H34O2 and a molecular weight of 366.55 g/mol. Its IUPAC name is benzyl (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate.
| Compound Name | benzyl (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate |
|---|---|
| PubChem CID | 151994242 |
| Molecular Formula | C25H34O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | benzyl (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-25(26)27-23-24-20-17-16-18-21-24/h3-4,6-7,9-10,12-13,16-18,20-21H,2,5,8,11,14-15,19,22-23H2,1H3/b4-3-,7-6-,10-9-,13-12- |
| InChIKey | UFIHBOQTOJKALQ-LTKCOYKYSA-N |
| XLogP | 7.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|