C17H28O3 — CID 10612787
2-(7-phenylmethoxyheptyl)propane-1,3-diol (PubChem CID 10612787) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-(7-phenylmethoxyheptyl)propane-1,3-diol.
| Compound Name | 2-(7-phenylmethoxyheptyl)propane-1,3-diol |
|---|---|
| PubChem CID | 10612787 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 2-(7-phenylmethoxyheptyl)propane-1,3-diol |
| SMILES | OCC(CO)CCCCCCCOCc1ccccc1 |
| InChI | InChI=1S/C17H28O3/c18-13-17(14-19)11-5-2-1-3-8-12-20-15-16-9-6-4-7-10-16/h4,6-7,9-10,17-19H,1-3,5,8,11-15H2 |
| InChIKey | ZTHCTBIDWUZNFC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|