C22H30O5S — CID 10645035
[2-(hydroxymethyl)-7-phenylmethoxyheptyl] 4-methylbenzenesulfonate (PubChem CID 10645035) has the molecular formula C22H30O5S and a molecular weight of 406.54 g/mol. Its IUPAC name is [2-(hydroxymethyl)-7-phenylmethoxyheptyl] 4-methylbenzenesulfonate.
| Compound Name | [2-(hydroxymethyl)-7-phenylmethoxyheptyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10645035 |
| Molecular Formula | C22H30O5S |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | [2-(hydroxymethyl)-7-phenylmethoxyheptyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(CO)CCCCCOCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H30O5S/c1-19-11-13-22(14-12-19)28(24,25)27-18-21(16-23)10-6-3-7-15-26-17-20-8-4-2-5-9-20/h2,4-5,8-9,11-14,21,23H,3,6-7,10,15-18H2,1H3 |
| InChIKey | PVZDVDBGNVJTPP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|