C22H32O7S — CID 146318742
ethyl 4-methylbenzenesulfonate;2-[2-(2-phenylmethoxyethoxy)ethoxy]ethanol (PubChem CID 146318742) has the molecular formula C22H32O7S and a molecular weight of 440.56 g/mol. Its IUPAC name is ethyl 4-methylbenzenesulfonate;2-[2-(2-phenylmethoxyethoxy)ethoxy]ethanol.
| Compound Name | ethyl 4-methylbenzenesulfonate;2-[2-(2-phenylmethoxyethoxy)ethoxy]ethanol |
|---|---|
| PubChem CID | 146318742 |
| Molecular Formula | C22H32O7S |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | ethyl 4-methylbenzenesulfonate;2-[2-(2-phenylmethoxyethoxy)ethoxy]ethanol |
| SMILES | CCOS(=O)(=O)c1ccc(C)cc1.OCCOCCOCCOCc1ccccc1 |
| InChI | InChI=1S/C13H20O4.C9H12O3S/c14-6-7-15-8-9-16-10-11-17-12-13-4-2-1-3-5-13;1-3-12-13(10,11)9-6-4-8(2)5-7-9/h1-5,14H,6-12H2;4-7H,3H2,1-2H3 |
| InChIKey | CEMWLMKGEAGKQZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|