C13H23NO5S — CID 91080458
2-(2-aminoethoxy)ethanol;ethyl 4-methylbenzenesulfonate (PubChem CID 91080458) has the molecular formula C13H23NO5S and a molecular weight of 305.40 g/mol. Its IUPAC name is 2-(2-aminoethoxy)ethanol;ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-(2-aminoethoxy)ethanol;ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 91080458 |
| Molecular Formula | C13H23NO5S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-(2-aminoethoxy)ethanol;ethyl 4-methylbenzenesulfonate |
| SMILES | CCOS(=O)(=O)c1ccc(C)cc1.NCCOCCO |
| InChI | InChI=1S/C9H12O3S.C4H11NO2/c1-3-12-13(10,11)9-6-4-8(2)5-7-9;5-1-3-7-4-2-6/h4-7H,3H2,1-2H3;6H,1-5H2 |
| InChIKey | BZURKOZNMWVSLG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|