C13H21NO5S — CID 175036248
ethyl 2-[2-(2-aminoethoxy)ethoxy]-4-methylbenzenesulfonate (PubChem CID 175036248) has the molecular formula C13H21NO5S and a molecular weight of 303.38 g/mol. Its IUPAC name is ethyl 2-[2-(2-aminoethoxy)ethoxy]-4-methylbenzenesulfonate.
| Compound Name | ethyl 2-[2-(2-aminoethoxy)ethoxy]-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 175036248 |
| Molecular Formula | C13H21NO5S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | ethyl 2-[2-(2-aminoethoxy)ethoxy]-4-methylbenzenesulfonate |
| SMILES | CCOS(=O)(=O)c1ccc(C)cc1OCCOCCN |
| InChI | InChI=1S/C13H21NO5S/c1-3-19-20(15,16)13-5-4-11(2)10-12(13)18-9-8-17-7-6-14/h4-5,10H,3,6-9,14H2,1-2H3 |
| InChIKey | SGOOTUSQSHXXLR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|