C28H42O12S2 — CID 126673442
ethyl 4-methyl-2-[2-[2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzenesulfonate (PubChem CID 126673442) has the molecular formula C28H42O12S2 and a molecular weight of 634.77 g/mol. Its IUPAC name is ethyl 4-methyl-2-[2-[2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzenesulfonate.
| Compound Name | ethyl 4-methyl-2-[2-[2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzenesulfonate |
|---|---|
| PubChem CID | 126673442 |
| Molecular Formula | C28H42O12S2 |
| Molecular Weight | 634.77 g/mol |
| Exact Mass | 634.21 |
| IUPAC Name | ethyl 4-methyl-2-[2-[2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzenesulfonate |
| SMILES | CCOS(=O)(=O)c1ccc(C)cc1OCCOCCOCCOCCOCCOCCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H42O12S2/c1-4-39-42(31,32)28-10-7-25(3)23-27(28)38-21-19-36-17-15-34-13-11-33-12-14-35-16-18-37-20-22-40-41(29,30)26-8-5-24(2)6-9-26/h5-10,23H,4,11-22H2,1-3H3 |
| InChIKey | FZCMUOYKHGIAOT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.77 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|