C23H42O9S2 — CID 158546099
2-[2-(2-ethoxyethoxy)ethoxy]ethanethiol;2-[2-(2-ethoxyethoxy)ethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 158546099) has the molecular formula C23H42O9S2 and a molecular weight of 526.71 g/mol. Its IUPAC name is 2-[2-(2-ethoxyethoxy)ethoxy]ethanethiol;2-[2-(2-ethoxyethoxy)ethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-(2-ethoxyethoxy)ethoxy]ethanethiol;2-[2-(2-ethoxyethoxy)ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 158546099 |
| Molecular Formula | C23H42O9S2 |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 2-[2-(2-ethoxyethoxy)ethoxy]ethanethiol;2-[2-(2-ethoxyethoxy)ethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | CCOCCOCCOCCOS(=O)(=O)c1ccc(C)cc1.CCOCCOCCOCCS |
| InChI | InChI=1S/C15H24O6S.C8H18O3S/c1-3-18-8-9-19-10-11-20-12-13-21-22(16,17)15-6-4-14(2)5-7-15;1-2-9-3-4-10-5-6-11-7-8-12/h4-7H,3,8-13H2,1-2H3;12H,2-8H2,1H3 |
| InChIKey | HPDAXBXFSZPEPE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 98.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|