C17H29O8PS — CID 138597163
2-[2-(2-diethoxyphosphorylethoxy)ethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 138597163) has the molecular formula C17H29O8PS and a molecular weight of 424.45 g/mol. Its IUPAC name is 2-[2-(2-diethoxyphosphorylethoxy)ethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-(2-diethoxyphosphorylethoxy)ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 138597163 |
| Molecular Formula | C17H29O8PS |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 2-[2-(2-diethoxyphosphorylethoxy)ethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | CCOP(=O)(CCOCCOCCOS(=O)(=O)c1ccc(C)cc1)OCC |
| InChI | InChI=1S/C17H29O8PS/c1-4-23-26(18,24-5-2)15-14-22-11-10-21-12-13-25-27(19,20)17-8-6-16(3)7-9-17/h6-9H,4-5,10-15H2,1-3H3 |
| InChIKey | XGMAQWINXNFRBI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|