C12H18O5S — CID 87667048
ethyl 2-(2-methoxyethoxy)-4-methylbenzenesulfonate (PubChem CID 87667048) has the molecular formula C12H18O5S and a molecular weight of 274.34 g/mol. Its IUPAC name is ethyl 2-(2-methoxyethoxy)-4-methylbenzenesulfonate.
| Compound Name | ethyl 2-(2-methoxyethoxy)-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87667048 |
| Molecular Formula | C12H18O5S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | ethyl 2-(2-methoxyethoxy)-4-methylbenzenesulfonate |
| SMILES | CCOS(=O)(=O)c1ccc(C)cc1OCCOC |
| InChI | InChI=1S/C12H18O5S/c1-4-17-18(13,14)12-6-5-10(2)9-11(12)16-8-7-15-3/h5-6,9H,4,7-8H2,1-3H3 |
| InChIKey | VXSFLIHLWHHQQC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|