C26H28N2O8S — CID 174995491
ethyl 2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxoisoquinolin-3-yl]methoxy]ethoxy]-4-methylbenzenesulfonate (PubChem CID 174995491) has the molecular formula C26H28N2O8S and a molecular weight of 528.58 g/mol. Its IUPAC name is ethyl 2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxoisoquinolin-3-yl]methoxy]ethoxy]-4-methylbenzenesulfonate.
| Compound Name | ethyl 2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxoisoquinolin-3-yl]methoxy]ethoxy]-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 174995491 |
| Molecular Formula | C26H28N2O8S |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | ethyl 2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxoisoquinolin-3-yl]methoxy]ethoxy]-4-methylbenzenesulfonate |
| SMILES | CCOS(=O)(=O)c1ccc(C)cc1OCCOCc1cc2ccccc2c(=O)n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C26H28N2O8S/c1-3-36-37(32,33)23-10-8-17(2)14-22(23)35-13-12-34-16-19-15-18-6-4-5-7-20(18)26(31)28(19)21-9-11-24(29)27-25(21)30/h4-8,10,14-15,21H,3,9,11-13,16H2,1-2H3,(H,27,29,30) |
| InChIKey | SHTWSPUVSRYIFT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|