C20H27N3O6 — CID 176968261
3-[3-methyl-2-oxo-4-[2-(2-propoxyethoxy)ethoxy]benzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 176968261) has the molecular formula C20H27N3O6 and a molecular weight of 405.45 g/mol. Its IUPAC name is 3-[3-methyl-2-oxo-4-[2-(2-propoxyethoxy)ethoxy]benzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-methyl-2-oxo-4-[2-(2-propoxyethoxy)ethoxy]benzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176968261 |
| Molecular Formula | C20H27N3O6 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 3-[3-methyl-2-oxo-4-[2-(2-propoxyethoxy)ethoxy]benzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | CCCOCCOCCOc1cccc2c1n(C)c(=O)n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C20H27N3O6/c1-3-9-27-10-11-28-12-13-29-16-6-4-5-14-18(16)22(2)20(26)23(14)15-7-8-17(24)21-19(15)25/h4-6,15H,3,7-13H2,1-2H3,(H,21,24,25) |
| InChIKey | UQNDGHPSGDXPEV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|