C16H17N3O3 — CID 164567593
3-(3-methyl-2-oxo-4-prop-1-en-2-ylbenzimidazol-1-yl)piperidine-2,6-dione (PubChem CID 164567593) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 3-(3-methyl-2-oxo-4-prop-1-en-2-ylbenzimidazol-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(3-methyl-2-oxo-4-prop-1-en-2-ylbenzimidazol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 164567593 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3-(3-methyl-2-oxo-4-prop-1-en-2-ylbenzimidazol-1-yl)piperidine-2,6-dione |
| SMILES | C=C(C)c1cccc2c1n(C)c(=O)n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C16H17N3O3/c1-9(2)10-5-4-6-11-14(10)18(3)16(22)19(11)12-7-8-13(20)17-15(12)21/h4-6,12H,1,7-8H2,2-3H3,(H,17,20,21) |
| InChIKey | YTNBLXBODGFYLM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|