C16H21N3O3 — CID 163400444
3-(3,4-dimethyl-2-oxobenzimidazol-1-yl)piperidine-2,6-dione;ethane (PubChem CID 163400444) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 3-(3,4-dimethyl-2-oxobenzimidazol-1-yl)piperidine-2,6-dione;ethane.
| Compound Name | 3-(3,4-dimethyl-2-oxobenzimidazol-1-yl)piperidine-2,6-dione;ethane |
|---|---|
| PubChem CID | 163400444 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 3-(3,4-dimethyl-2-oxobenzimidazol-1-yl)piperidine-2,6-dione;ethane |
| SMILES | CC.Cc1cccc2c1n(C)c(=O)n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H15N3O3.C2H6/c1-8-4-3-5-9-12(8)16(2)14(20)17(9)10-6-7-11(18)15-13(10)19;1-2/h3-5,10H,6-7H2,1-2H3,(H,15,18,19);1-2H3 |
| InChIKey | GMCQGMNIGLAJLZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|