C14H15N3O3 — CID 156836715
3-(3,7-dimethyl-2-oxobenzimidazol-1-yl)piperidine-2,6-dione (PubChem CID 156836715) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 3-(3,7-dimethyl-2-oxobenzimidazol-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(3,7-dimethyl-2-oxobenzimidazol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 156836715 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 3-(3,7-dimethyl-2-oxobenzimidazol-1-yl)piperidine-2,6-dione |
| SMILES | Cc1cccc2c1n(C1CCC(=O)NC1=O)c(=O)n2C |
| InChI | InChI=1S/C14H15N3O3/c1-8-4-3-5-9-12(8)17(14(20)16(9)2)10-6-7-11(18)15-13(10)19/h3-5,10H,6-7H2,1-2H3,(H,15,18,19) |
| InChIKey | ABZFKJSKWFDYRG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|