C16H19N3O3 — CID 138727887
3-(3-methyl-2-oxo-5-propan-2-ylbenzimidazol-1-yl)piperidine-2,6-dione (PubChem CID 138727887) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-(3-methyl-2-oxo-5-propan-2-ylbenzimidazol-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(3-methyl-2-oxo-5-propan-2-ylbenzimidazol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 138727887 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 3-(3-methyl-2-oxo-5-propan-2-ylbenzimidazol-1-yl)piperidine-2,6-dione |
| SMILES | CC(C)c1ccc2c(c1)n(C)c(=O)n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C16H19N3O3/c1-9(2)10-4-5-11-13(8-10)18(3)16(22)19(11)12-6-7-14(20)17-15(12)21/h4-5,8-9,12H,6-7H2,1-3H3,(H,17,20,21) |
| InChIKey | RIBCHKNAWONHQZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|