C18H23N4O3P — CID 176963119
3-[3-methyl-2-oxo-5-(4-phosphanylpiperidin-1-yl)benzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 176963119) has the molecular formula C18H23N4O3P and a molecular weight of 374.38 g/mol. Its IUPAC name is 3-[3-methyl-2-oxo-5-(4-phosphanylpiperidin-1-yl)benzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-methyl-2-oxo-5-(4-phosphanylpiperidin-1-yl)benzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176963119 |
| Molecular Formula | C18H23N4O3P |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 3-[3-methyl-2-oxo-5-(4-phosphanylpiperidin-1-yl)benzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(N3CCC(P)CC3)cc21 |
| InChI | InChI=1S/C18H23N4O3P/c1-20-15-10-11(21-8-6-12(26)7-9-21)2-3-13(15)22(18(20)25)14-4-5-16(23)19-17(14)24/h2-3,10,12,14H,4-9,26H2,1H3,(H,19,23,24) |
| InChIKey | YIHRLNKMRJQMCN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|