C17H21N5O3 — CID 170706486
(3R)-3-(3-methyl-2-oxo-5-piperazin-1-ylbenzimidazol-1-yl)piperidine-2,6-dione (PubChem CID 170706486) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is (3R)-3-(3-methyl-2-oxo-5-piperazin-1-ylbenzimidazol-1-yl)piperidine-2,6-dione.
| Compound Name | (3R)-3-(3-methyl-2-oxo-5-piperazin-1-ylbenzimidazol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 170706486 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (3R)-3-(3-methyl-2-oxo-5-piperazin-1-ylbenzimidazol-1-yl)piperidine-2,6-dione |
| SMILES | Cn1c(=O)n([C@@H]2CCC(=O)NC2=O)c2ccc(N3CCNCC3)cc21 |
| InChI | InChI=1S/C17H21N5O3/c1-20-14-10-11(21-8-6-18-7-9-21)2-3-12(14)22(17(20)25)13-4-5-15(23)19-16(13)24/h2-3,10,13,18H,4-9H2,1H3,(H,19,23,24)/t13-/m1/s1 |
| InChIKey | OKHCRDBBACBERD-CYBMUJFWSA-N |
| XLogP | -0.27 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|