C22H29N5O5 — CID 155438203
tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]piperazine-1-carboxylate (PubChem CID 155438203) has the molecular formula C22H29N5O5 and a molecular weight of 443.50 g/mol. Its IUPAC name is tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 155438203 |
| Molecular Formula | C22H29N5O5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]piperazine-1-carboxylate |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)cc21 |
| InChI | InChI=1S/C22H29N5O5/c1-22(2,3)32-21(31)26-11-9-25(10-12-26)14-5-6-15-17(13-14)24(4)20(30)27(15)16-7-8-18(28)23-19(16)29/h5-6,13,16H,7-12H2,1-4H3,(H,23,28,29) |
| InChIKey | SILKHUGOGMJZIC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 105.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|