C25H29N5O6 — CID 170669672
tert-butyl 4-[2-(2,6-dioxopiperidin-3-yl)-4-methyl-1,3-dioxopyrrolo[3,4-b]indol-6-yl]piperazine-1-carboxylate (PubChem CID 170669672) has the molecular formula C25H29N5O6 and a molecular weight of 495.54 g/mol. Its IUPAC name is tert-butyl 4-[2-(2,6-dioxopiperidin-3-yl)-4-methyl-1,3-dioxopyrrolo[3,4-b]indol-6-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2,6-dioxopiperidin-3-yl)-4-methyl-1,3-dioxopyrrolo[3,4-b]indol-6-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170669672 |
| Molecular Formula | C25H29N5O6 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | tert-butyl 4-[2-(2,6-dioxopiperidin-3-yl)-4-methyl-1,3-dioxopyrrolo[3,4-b]indol-6-yl]piperazine-1-carboxylate |
| SMILES | Cn1c2c(c3ccc(N4CCN(C(=O)OC(C)(C)C)CC4)cc31)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C25H29N5O6/c1-25(2,3)36-24(35)29-11-9-28(10-12-29)14-5-6-15-17(13-14)27(4)20-19(15)22(33)30(23(20)34)16-7-8-18(31)26-21(16)32/h5-6,13,16H,7-12H2,1-4H3,(H,26,31,32) |
| InChIKey | BZUIKFKGFSEFBF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|