C24H30N4O7 — CID 156820716
tert-butyl 4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethyl]piperazine-1-carboxylate (PubChem CID 156820716) has the molecular formula C24H30N4O7 and a molecular weight of 486.53 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 156820716 |
| Molecular Formula | C24H30N4O7 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | tert-butyl 4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCOc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C24H30N4O7/c1-24(2,3)35-23(33)27-10-8-26(9-11-27)12-13-34-15-4-5-16-17(14-15)22(32)28(21(16)31)18-6-7-19(29)25-20(18)30/h4-5,14,18H,6-13H2,1-3H3,(H,25,29,30) |
| InChIKey | GNPASZCSKUAMGL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 125.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|