C23H27N3O7 — CID 171572268
tert-butyl 3-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethyl]azetidine-1-carboxylate (PubChem CID 171572268) has the molecular formula C23H27N3O7 and a molecular weight of 457.48 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 171572268 |
| Molecular Formula | C23H27N3O7 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | tert-butyl 3-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CCOc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C23H27N3O7/c1-23(2,3)33-22(31)25-11-13(12-25)8-9-32-14-4-5-15-16(10-14)21(30)26(20(15)29)17-6-7-18(27)24-19(17)28/h4-5,10,13,17H,6-9,11-12H2,1-3H3,(H,24,27,28) |
| InChIKey | BZNACCUMBABPOA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|