C32H42N4O8 — CID 166066158
tert-butyl 4-[2-[[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]methoxy]ethyl]piperidine-1-carboxylate (PubChem CID 166066158) has the molecular formula C32H42N4O8 and a molecular weight of 610.71 g/mol. Its IUPAC name is tert-butyl 4-[2-[[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]methoxy]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]methoxy]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166066158 |
| Molecular Formula | C32H42N4O8 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.30 |
| IUPAC Name | tert-butyl 4-[2-[[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]methoxy]ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCOCC2CCN(C(=O)c3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4=O)CC2)CC1 |
| InChI | InChI=1S/C32H42N4O8/c1-32(2,3)44-31(42)35-15-8-20(9-16-35)12-17-43-19-21-10-13-34(14-11-21)28(39)22-4-5-23-24(18-22)30(41)36(29(23)40)25-6-7-26(37)33-27(25)38/h4-5,18,20-21,25H,6-17,19H2,1-3H3,(H,33,37,38) |
| InChIKey | GMDADFBNAQYDNE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 142.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|